About 6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile
6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile (PubChem CID 167111714) has the molecular formula C12H10BrNS2
and a molecular weight of 312.26 g/mol. Its IUPAC name is 6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile.
Molecular Properties
| Compound Name | 6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile |
| PubChem CID | 167111714 |
| Molecular Formula | C12H10BrNS2 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 310.94 |
| IUPAC Name | 6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile |
| SMILES | N#Cc1cc2c(cc1Br)CCC21SCCS1 |
| InChI | InChI=1S/C12H10BrNS2/c13-11-6-8-1-2-12(15-3-4-16-12)10(8)5-9(11)7-14/h5-6H,1-4H2 |
| InChIKey | OKQYXPSBLVFDSN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile?
The IUPAC name of 6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile (CID 167111714) is 6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile.
What is the SMILES notation for 6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile?
The canonical SMILES for 6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile is N#Cc1cc2c(cc1Br)CCC21SCCS1.
What is the InChIKey of 6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile?
The InChIKey is OKQYXPSBLVFDSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrNS2/c13-11-6-8-1-2-12(15-3-4-16-12)10(8)5-9(11)7-14/h5-6H,1-4H2.
What are the key properties of 6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile?
6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile has a molecular weight of 312.26 g/mol, XLogP of 3.90, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromospiro[1,2-dihydroindene-3,2'-1,3-dithiolane]-5-carbonitrile is sourced from PubChem (CID 167111714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).