About 1-cyclopentyl-3,6-dimethyl-4H-pyridazine
1-cyclopentyl-3,6-dimethyl-4H-pyridazine (PubChem CID 167111827) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-cyclopentyl-3,6-dimethyl-4H-pyridazine.
Molecular Properties
| Compound Name | 1-cyclopentyl-3,6-dimethyl-4H-pyridazine |
| PubChem CID | 167111827 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-cyclopentyl-3,6-dimethyl-4H-pyridazine |
| SMILES | CC1=CCC(C)=NN1C1CCCC1 |
| InChI | InChI=1S/C11H18N2/c1-9-7-8-10(2)13(12-9)11-5-3-4-6-11/h8,11H,3-7H2,1-2H3 |
| InChIKey | BGHVUZSQTCHXLX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopentyl-3,6-dimethyl-4H-pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-3,6-dimethyl-4H-pyridazine?
The IUPAC name of 1-cyclopentyl-3,6-dimethyl-4H-pyridazine (CID 167111827) is 1-cyclopentyl-3,6-dimethyl-4H-pyridazine.
What is the SMILES notation for 1-cyclopentyl-3,6-dimethyl-4H-pyridazine?
The canonical SMILES for 1-cyclopentyl-3,6-dimethyl-4H-pyridazine is CC1=CCC(C)=NN1C1CCCC1.
What is the InChIKey of 1-cyclopentyl-3,6-dimethyl-4H-pyridazine?
The InChIKey is BGHVUZSQTCHXLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-9-7-8-10(2)13(12-9)11-5-3-4-6-11/h8,11H,3-7H2,1-2H3.
What are the key properties of 1-cyclopentyl-3,6-dimethyl-4H-pyridazine?
1-cyclopentyl-3,6-dimethyl-4H-pyridazine has a molecular weight of 178.28 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-3,6-dimethyl-4H-pyridazine is sourced from PubChem (CID 167111827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).