C24H20N2O10S4 — CID 167112396
2-hydroxyethyl 2-cyano-2-[2-[1-cyano-2-(2-hydroxyethoxy)-2-oxoethylidene]-4,8-di(propanoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate (PubChem CID 167112396) has the molecular formula C24H20N2O10S4 and a molecular weight of 624.70 g/mol. Its IUPAC name is 2-hydroxyethyl 2-cyano-2-[2-[1-cyano-2-(2-hydroxyethoxy)-2-oxoethylidene]-4,8-di(propanoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate.
| Compound Name | 2-hydroxyethyl 2-cyano-2-[2-[1-cyano-2-(2-hydroxyethoxy)-2-oxoethylidene]-4,8-di(propanoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate |
|---|---|
| PubChem CID | 167112396 |
| Molecular Formula | C24H20N2O10S4 |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 624.00 |
| IUPAC Name | 2-hydroxyethyl 2-cyano-2-[2-[1-cyano-2-(2-hydroxyethoxy)-2-oxoethylidene]-4,8-di(propanoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate |
| SMILES | CCC(=O)Oc1c2c(c(OC(=O)CC)c3c1SC(=C(C#N)C(=O)OCCO)S3)SC(=C(C#N)C(=O)OCCO)S2 |
| InChI | InChI=1S/C24H20N2O10S4/c1-3-13(29)35-15-17-19(39-23(37-17)11(9-25)21(31)33-7-5-27)16(36-14(30)4-2)20-18(15)38-24(40-20)12(10-26)22(32)34-8-6-28/h27-28H,3-8H2,1-2H3/b23-11-,24-12+ |
| InChIKey | GTVWTWUGJUJYCS-QEUMEHMPSA-N |
| XLogP | 3.25 |
| TPSA | 193.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|