C24H28N2 — CID 167112690
3-(2-cyclooctylethynyl)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]imidazo[1,2-a]pyridine (PubChem CID 167112690) has the molecular formula C24H28N2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 3-(2-cyclooctylethynyl)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]imidazo[1,2-a]pyridine.
| Compound Name | 3-(2-cyclooctylethynyl)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 167112690 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 3-(2-cyclooctylethynyl)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]imidazo[1,2-a]pyridine |
| SMILES | C=C/C(=C\C=C/C)c1ccc2ncc(C#CC3CCCCCCC3)n2c1 |
| InChI | InChI=1S/C24H28N2/c1-3-5-13-21(4-2)22-15-17-24-25-18-23(26(24)19-22)16-14-20-11-9-7-6-8-10-12-20/h3-5,13,15,17-20H,2,6-12H2,1H3/b5-3-,21-13+ |
| InChIKey | DYNVANCYLWQGAZ-BWFWUWGJSA-N |
| XLogP | 6.19 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|