C25H44FNO — CID 167113110
(4Z,6E)-7-ethenyl-10-fluoro-6-methoxy-N,4-dimethyl-N-[3-methylidene-2-(2-methylpropyl)pentyl]deca-4,6-dien-1-amine (PubChem CID 167113110) has the molecular formula C25H44FNO and a molecular weight of 393.63 g/mol. Its IUPAC name is (4Z,6E)-7-ethenyl-10-fluoro-6-methoxy-N,4-dimethyl-N-[3-methylidene-2-(2-methylpropyl)pentyl]deca-4,6-dien-1-amine.
| Compound Name | (4Z,6E)-7-ethenyl-10-fluoro-6-methoxy-N,4-dimethyl-N-[3-methylidene-2-(2-methylpropyl)pentyl]deca-4,6-dien-1-amine |
|---|---|
| PubChem CID | 167113110 |
| Molecular Formula | C25H44FNO |
| Molecular Weight | 393.63 g/mol |
| Exact Mass | 393.34 |
| IUPAC Name | (4Z,6E)-7-ethenyl-10-fluoro-6-methoxy-N,4-dimethyl-N-[3-methylidene-2-(2-methylpropyl)pentyl]deca-4,6-dien-1-amine |
| SMILES | C=C/C(CCCF)=C(\C=C(\C)CCCN(C)CC(CC(C)C)C(=C)CC)OC |
| InChI | InChI=1S/C25H44FNO/c1-9-22(6)24(17-20(3)4)19-27(7)16-12-13-21(5)18-25(28-8)23(10-2)14-11-15-26/h10,18,20,24H,2,6,9,11-17,19H2,1,3-5,7-8H3/b21-18-,25-23- |
| InChIKey | FDPYVNUHXAKURW-VKRNAMELSA-N |
| XLogP | 7.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.63 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|