About 7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine
7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine (PubChem CID 167113346) has the molecular formula C16H19ClN2OS2
and a molecular weight of 354.93 g/mol. Its IUPAC name is 7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine.
Molecular Properties
| Compound Name | 7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine |
| PubChem CID | 167113346 |
| Molecular Formula | C16H19ClN2OS2 |
| Molecular Weight | 354.93 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine |
| SMILES | COCCCNC1c2ccc(Cl)cc2SN(C)c2ccsc21 |
| InChI | InChI=1S/C16H19ClN2OS2/c1-19-13-6-9-21-16(13)15(18-7-3-8-20-2)12-5-4-11(17)10-14(12)22-19/h4-6,9-10,15,18H,3,7-8H2,1-2H3 |
| InChIKey | IOTXLUJUXBAZKU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.93 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine?
The IUPAC name of 7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine (CID 167113346) is 7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine.
What is the SMILES notation for 7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine?
The canonical SMILES for 7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine is COCCCNC1c2ccc(Cl)cc2SN(C)c2ccsc21.
What is the InChIKey of 7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine?
The InChIKey is IOTXLUJUXBAZKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN2OS2/c1-19-13-6-9-21-16(13)15(18-7-3-8-20-2)12-5-4-11(17)10-14(12)22-19/h4-6,9-10,15,18H,3,7-8H2,1-2H3.
What are the key properties of 7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine?
7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine has a molecular weight of 354.93 g/mol, XLogP of 4.57, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine is sourced from PubChem (CID 167113346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).