About 1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine
1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine (PubChem CID 167113821) has the molecular formula C13H22FN
and a molecular weight of 211.32 g/mol. Its IUPAC name is 1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine |
| PubChem CID | 167113821 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine |
| SMILES | C=C(F)C1=CN(C(C)(C)C)CCC1(C)C |
| InChI | InChI=1S/C13H22FN/c1-10(14)11-9-15(12(2,3)4)8-7-13(11,5)6/h9H,1,7-8H2,2-6H3 |
| InChIKey | DHVWZNAUJWLCKL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine?
The IUPAC name of 1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine (CID 167113821) is 1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine.
What is the SMILES notation for 1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine?
The canonical SMILES for 1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine is C=C(F)C1=CN(C(C)(C)C)CCC1(C)C.
What is the InChIKey of 1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine?
The InChIKey is DHVWZNAUJWLCKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22FN/c1-10(14)11-9-15(12(2,3)4)8-7-13(11,5)6/h9H,1,7-8H2,2-6H3.
What are the key properties of 1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine?
1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine has a molecular weight of 211.32 g/mol, XLogP of 3.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-5-(1-fluoroethenyl)-4,4-dimethyl-2,3-dihydropyridine is sourced from PubChem (CID 167113821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).