C18H16ClF2N7O2 — CID 167113824
2-amino-N-[(E,1Z)-1-[5-chloro-2-(difluoromethoxy)phenyl]-1-hydrazinylidenebut-2-en-2-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 167113824) has the molecular formula C18H16ClF2N7O2 and a molecular weight of 435.82 g/mol. Its IUPAC name is 2-amino-N-[(E,1Z)-1-[5-chloro-2-(difluoromethoxy)phenyl]-1-hydrazinylidenebut-2-en-2-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-N-[(E,1Z)-1-[5-chloro-2-(difluoromethoxy)phenyl]-1-hydrazinylidenebut-2-en-2-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 167113824 |
| Molecular Formula | C18H16ClF2N7O2 |
| Molecular Weight | 435.82 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 2-amino-N-[(E,1Z)-1-[5-chloro-2-(difluoromethoxy)phenyl]-1-hydrazinylidenebut-2-en-2-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | C/C=C(NC(=O)c1c(N)nn2cccnc12)\C(=N/N)c1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C18H16ClF2N7O2/c1-2-11(14(26-23)10-8-9(19)4-5-12(10)30-18(20)21)25-17(29)13-15(22)27-28-7-3-6-24-16(13)28/h2-8,18H,23H2,1H3,(H2,22,27)(H,25,29)/b11-2+,26-14- |
| InChIKey | WKYQTDDWHVUFPM-OVPRLKIGSA-N |
| XLogP | 2.56 |
| TPSA | 132.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.82 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|