C17H17N3O2 — CID 167114634
4-[(3,4-dihydroquinolin-5-ylamino)methyl]-N-hydroxybenzamide (PubChem CID 167114634) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-[(3,4-dihydroquinolin-5-ylamino)methyl]-N-hydroxybenzamide.
| Compound Name | 4-[(3,4-dihydroquinolin-5-ylamino)methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 167114634 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 4-[(3,4-dihydroquinolin-5-ylamino)methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(CNc2cccc3c2CCC=N3)cc1 |
| InChI | InChI=1S/C17H17N3O2/c21-17(20-22)13-8-6-12(7-9-13)11-19-16-5-1-4-15-14(16)3-2-10-18-15/h1,4-10,19,22H,2-3,11H2,(H,20,21) |
| InChIKey | XTNHSRXYDGBKCU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|