C25H34F2O3S2 — CID 167114746
S-[4,4-difluoro-7-(2-oxochromen-4-yl)sulfanylheptyl] 2,2,5-trimethylhexanethioate (PubChem CID 167114746) has the molecular formula C25H34F2O3S2 and a molecular weight of 484.67 g/mol. Its IUPAC name is S-[4,4-difluoro-7-(2-oxochromen-4-yl)sulfanylheptyl] 2,2,5-trimethylhexanethioate.
| Compound Name | S-[4,4-difluoro-7-(2-oxochromen-4-yl)sulfanylheptyl] 2,2,5-trimethylhexanethioate |
|---|---|
| PubChem CID | 167114746 |
| Molecular Formula | C25H34F2O3S2 |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | S-[4,4-difluoro-7-(2-oxochromen-4-yl)sulfanylheptyl] 2,2,5-trimethylhexanethioate |
| SMILES | CC(C)CCC(C)(C)C(=O)SCCCC(F)(F)CCCSc1cc(=O)oc2ccccc12 |
| InChI | InChI=1S/C25H34F2O3S2/c1-18(2)11-14-24(3,4)23(29)32-16-8-13-25(26,27)12-7-15-31-21-17-22(28)30-20-10-6-5-9-19(20)21/h5-6,9-10,17-18H,7-8,11-16H2,1-4H3 |
| InChIKey | OADNGXZSWQKPPM-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|