C25H28F4N4O3S — CID 167115445
(12S)-8-(4-fluorophenyl)-12-(2-methoxyethoxy)-4-piperazin-1-yl-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-ol (PubChem CID 167115445) has the molecular formula C25H28F4N4O3S and a molecular weight of 540.58 g/mol. Its IUPAC name is (12S)-8-(4-fluorophenyl)-12-(2-methoxyethoxy)-4-piperazin-1-yl-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-ol.
| Compound Name | (12S)-8-(4-fluorophenyl)-12-(2-methoxyethoxy)-4-piperazin-1-yl-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-ol |
|---|---|
| PubChem CID | 167115445 |
| Molecular Formula | C25H28F4N4O3S |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | (12S)-8-(4-fluorophenyl)-12-(2-methoxyethoxy)-4-piperazin-1-yl-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-ol |
| SMILES | COCCO[C@@H]1CSc2c(-c3ccc(F)cc3)c(C(F)(F)F)cc3c2N(C1)C(O)N=C3N1CCNCC1 |
| InChI | InChI=1S/C25H28F4N4O3S/c1-35-10-11-36-17-13-33-21-18(23(31-24(33)34)32-8-6-30-7-9-32)12-19(25(27,28)29)20(22(21)37-14-17)15-2-4-16(26)5-3-15/h2-5,12,17,24,30,34H,6-11,13-14H2,1H3/t17-,24?/m0/s1 |
| InChIKey | GYVJWKJCKKPJAE-KEJDIYNNSA-N |
| XLogP | 3.40 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|