C29H41FN4 — CID 167115679
1-[(1Z,5Z,9Z,11Z)-16-ethyl-15-fluoro-10-methyl-5-(methylideneamino)-3-azabicyclo[10.4.0]hexadeca-1,5,9,11,13,15-hexaen-6-yl]-1-(3-methylpiperidin-1-yl)-N-propylmethanimine (PubChem CID 167115679) has the molecular formula C29H41FN4 and a molecular weight of 464.67 g/mol. Its IUPAC name is 1-[(1Z,5Z,9Z,11Z)-16-ethyl-15-fluoro-10-methyl-5-(methylideneamino)-3-azabicyclo[10.4.0]hexadeca-1,5,9,11,13,15-hexaen-6-yl]-1-(3-methylpiperidin-1-yl)-N-propylmethanimine.
| Compound Name | 1-[(1Z,5Z,9Z,11Z)-16-ethyl-15-fluoro-10-methyl-5-(methylideneamino)-3-azabicyclo[10.4.0]hexadeca-1,5,9,11,13,15-hexaen-6-yl]-1-(3-methylpiperidin-1-yl)-N-propylmethanimine |
|---|---|
| PubChem CID | 167115679 |
| Molecular Formula | C29H41FN4 |
| Molecular Weight | 464.67 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | 1-[(1Z,5Z,9Z,11Z)-16-ethyl-15-fluoro-10-methyl-5-(methylideneamino)-3-azabicyclo[10.4.0]hexadeca-1,5,9,11,13,15-hexaen-6-yl]-1-(3-methylpiperidin-1-yl)-N-propylmethanimine |
| SMILES | C=N/C1=C(C(=N\CCC)\N2CCCC(C)C2)/CC/C=C(C)\C=c2\ccc(F)c(CC)\c2=C/NC1 |
| InChI | InChI=1S/C29H41FN4/c1-6-15-33-29(34-16-9-11-22(4)20-34)25-12-8-10-21(3)17-23-13-14-27(30)24(7-2)26(23)18-32-19-28(25)31-5/h10,13-14,17-18,22,32H,5-9,11-12,15-16,19-20H2,1-4H3/b21-10-,23-17-,26-18-,28-25-,33-29- |
| InChIKey | VERCGHUSOFVPTB-JHALGIMJSA-N |
| XLogP | 4.73 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.67 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|