About 5-pyrrolidin-2-yl-3,4-dihydropyridine
5-pyrrolidin-2-yl-3,4-dihydropyridine (PubChem CID 167116216) has the molecular formula C9H14N2
and a molecular weight of 150.23 g/mol. Its IUPAC name is 5-pyrrolidin-2-yl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 5-pyrrolidin-2-yl-3,4-dihydropyridine |
| PubChem CID | 167116216 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.23 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 5-pyrrolidin-2-yl-3,4-dihydropyridine |
| SMILES | C1=NC=C(C2CCCN2)CC1 |
| InChI | InChI=1S/C9H14N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h5,7,9,11H,1-4,6H2 |
| InChIKey | QKNNRWIXTNJMGK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-pyrrolidin-2-yl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrrolidin-2-yl-3,4-dihydropyridine?
The IUPAC name of 5-pyrrolidin-2-yl-3,4-dihydropyridine (CID 167116216) is 5-pyrrolidin-2-yl-3,4-dihydropyridine.
What is the SMILES notation for 5-pyrrolidin-2-yl-3,4-dihydropyridine?
The canonical SMILES for 5-pyrrolidin-2-yl-3,4-dihydropyridine is C1=NC=C(C2CCCN2)CC1.
What is the InChIKey of 5-pyrrolidin-2-yl-3,4-dihydropyridine?
The InChIKey is QKNNRWIXTNJMGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h5,7,9,11H,1-4,6H2.
What are the key properties of 5-pyrrolidin-2-yl-3,4-dihydropyridine?
5-pyrrolidin-2-yl-3,4-dihydropyridine has a molecular weight of 150.23 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrrolidin-2-yl-3,4-dihydropyridine is sourced from PubChem (CID 167116216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).