C30H34F3N5O2 — CID 167116240
N-[5-[1-(oxetan-3-yl)-2,3,6,7-tetrahydroazepin-4-yl]-2-pyridinyl]-N'-[(1E)-3-(3-phenyl-1,2-oxazolidin-2-yl)-2-(trifluoromethyl)buta-1,3-dienyl]ethanimidamide (PubChem CID 167116240) has the molecular formula C30H34F3N5O2 and a molecular weight of 553.63 g/mol. Its IUPAC name is N-[5-[1-(oxetan-3-yl)-2,3,6,7-tetrahydroazepin-4-yl]-2-pyridinyl]-N'-[(1E)-3-(3-phenyl-1,2-oxazolidin-2-yl)-2-(trifluoromethyl)buta-1,3-dienyl]ethanimidamide.
| Compound Name | N-[5-[1-(oxetan-3-yl)-2,3,6,7-tetrahydroazepin-4-yl]-2-pyridinyl]-N'-[(1E)-3-(3-phenyl-1,2-oxazolidin-2-yl)-2-(trifluoromethyl)buta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 167116240 |
| Molecular Formula | C30H34F3N5O2 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | N-[5-[1-(oxetan-3-yl)-2,3,6,7-tetrahydroazepin-4-yl]-2-pyridinyl]-N'-[(1E)-3-(3-phenyl-1,2-oxazolidin-2-yl)-2-(trifluoromethyl)buta-1,3-dienyl]ethanimidamide |
| SMILES | C=C(/C(=C\N=C(/C)Nc1ccc(C2=CCCN(C3COC3)CC2)cn1)C(F)(F)F)N1OCCC1c1ccccc1 |
| InChI | InChI=1S/C30H34F3N5O2/c1-21(38-28(13-16-40-38)24-7-4-3-5-8-24)27(30(31,32)33)18-34-22(2)36-29-11-10-25(17-35-29)23-9-6-14-37(15-12-23)26-19-39-20-26/h3-5,7-11,17-18,26,28H,1,6,12-16,19-20H2,2H3,(H,34,35,36)/b27-18+ |
| InChIKey | XNSVPVXJLUOXMW-OVVQPSECSA-N |
| XLogP | 6.13 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|