About 2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide
2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide (PubChem CID 167116966) has the molecular formula C10H19F3N2OS
and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide.
Molecular Properties
| Compound Name | 2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide |
| PubChem CID | 167116966 |
| Molecular Formula | C10H19F3N2OS |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide |
| SMILES | CN1CC(C(NS(=O)C(C)(C)C)C(F)(F)F)C1 |
| InChI | InChI=1S/C10H19F3N2OS/c1-9(2,3)17(16)14-8(10(11,12)13)7-5-15(4)6-7/h7-8,14H,5-6H2,1-4H3 |
| InChIKey | WXJBHCQIYAPNIK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide?
The IUPAC name of 2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide (CID 167116966) is 2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide.
What is the SMILES notation for 2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide?
The canonical SMILES for 2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide is CN1CC(C(NS(=O)C(C)(C)C)C(F)(F)F)C1.
What is the InChIKey of 2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide?
The InChIKey is WXJBHCQIYAPNIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2OS/c1-9(2,3)17(16)14-8(10(11,12)13)7-5-15(4)6-7/h7-8,14H,5-6H2,1-4H3.
What are the key properties of 2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide?
2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide has a molecular weight of 272.34 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[2,2,2-trifluoro-1-(1-methylazetidin-3-yl)ethyl]propane-2-sulfinamide is sourced from PubChem (CID 167116966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).