C6H9F6NO — CID 167116988
1,1,1,5,5,5-hexafluoro-4-methoxypentan-2-amine (PubChem CID 167116988) has the molecular formula C6H9F6NO and a molecular weight of 225.13 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-4-methoxypentan-2-amine.
| Compound Name | 1,1,1,5,5,5-hexafluoro-4-methoxypentan-2-amine |
|---|---|
| PubChem CID | 167116988 |
| Molecular Formula | C6H9F6NO |
| Molecular Weight | 225.13 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-4-methoxypentan-2-amine |
| SMILES | COC(CC(N)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H9F6NO/c1-14-4(6(10,11)12)2-3(13)5(7,8)9/h3-4H,2,13H2,1H3 |
| InChIKey | RPIPUMIYQAJJBU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.13 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |