About 2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide
2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide (PubChem CID 167117082) has the molecular formula C10H20F3NOS
and a molecular weight of 259.34 g/mol. Its IUPAC name is 2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide.
Molecular Properties
| Compound Name | 2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide |
| PubChem CID | 167117082 |
| Molecular Formula | C10H20F3NOS |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide |
| SMILES | CCC(CCC(F)(F)F)NS(=O)C(C)(C)C |
| InChI | InChI=1S/C10H20F3NOS/c1-5-8(6-7-10(11,12)13)14-16(15)9(2,3)4/h8,14H,5-7H2,1-4H3 |
| InChIKey | SNYRQNXQIWOLDP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide?
The IUPAC name of 2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide (CID 167117082) is 2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide.
What is the SMILES notation for 2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide?
The canonical SMILES for 2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide is CCC(CCC(F)(F)F)NS(=O)C(C)(C)C.
What is the InChIKey of 2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide?
The InChIKey is SNYRQNXQIWOLDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F3NOS/c1-5-8(6-7-10(11,12)13)14-16(15)9(2,3)4/h8,14H,5-7H2,1-4H3.
What are the key properties of 2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide?
2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide has a molecular weight of 259.34 g/mol, XLogP of 3.16, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(6,6,6-trifluorohexan-3-yl)propane-2-sulfinamide is sourced from PubChem (CID 167117082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).