C10H18O6 — CID 167117111
(2S,3S,4R,5R,6R)-5-tert-butyl-3,4,6-trihydroxyoxane-2-carboxylic acid (PubChem CID 167117111) has the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-5-tert-butyl-3,4,6-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5R,6R)-5-tert-butyl-3,4,6-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 167117111 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (2S,3S,4R,5R,6R)-5-tert-butyl-3,4,6-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC(C)(C)[C@@H]1[C@@H](O)[C@H](O)[C@@H](C(=O)O)O[C@H]1O |
| InChI | InChI=1S/C10H18O6/c1-10(2,3)4-5(11)6(12)7(8(13)14)16-9(4)15/h4-7,9,11-12,15H,1-3H3,(H,13,14)/t4-,5-,6+,7+,9-/m1/s1 |
| InChIKey | OJLGYRWWOGYDEJ-CRYJZLASSA-N |
| XLogP | -0.83 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |