About (R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide
(R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide (PubChem CID 167117121) has the molecular formula C9H18F3NOS2
and a molecular weight of 277.38 g/mol. Its IUPAC name is (R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide.
Molecular Properties
| Compound Name | (R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide |
| PubChem CID | 167117121 |
| Molecular Formula | C9H18F3NOS2 |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | (R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide |
| SMILES | CSCC[C@H](N[S@](=O)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H18F3NOS2/c1-8(2,3)16(14)13-7(5-6-15-4)9(10,11)12/h7,13H,5-6H2,1-4H3/t7-,16+/m0/s1 |
| InChIKey | TWBVDRQYWKGKDX-HYORBCNSSA-N |
| XLogP | 2.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide?
The IUPAC name of (R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide (CID 167117121) is (R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide.
What is the SMILES notation for (R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide?
The canonical SMILES for (R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide is CSCC[C@H](N[S@](=O)C(C)(C)C)C(F)(F)F.
What is the InChIKey of (R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide?
The InChIKey is TWBVDRQYWKGKDX-HYORBCNSSA-N. The full InChI is InChI=1S/C9H18F3NOS2/c1-8(2,3)16(14)13-7(5-6-15-4)9(10,11)12/h7,13H,5-6H2,1-4H3/t7-,16+/m0/s1.
What are the key properties of (R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide?
(R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide has a molecular weight of 277.38 g/mol, XLogP of 2.72, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-2-methyl-N-[(2S)-1,1,1-trifluoro-4-methylsulfanylbutan-2-yl]propane-2-sulfinamide is sourced from PubChem (CID 167117121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).