C12H22N2O — CID 167118087
(3E,5R,6R)-6-(methylamino)-4-(methyliminomethyl)nona-1,3-dien-5-ol (PubChem CID 167118087) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (3E,5R,6R)-6-(methylamino)-4-(methyliminomethyl)nona-1,3-dien-5-ol.
| Compound Name | (3E,5R,6R)-6-(methylamino)-4-(methyliminomethyl)nona-1,3-dien-5-ol |
|---|---|
| PubChem CID | 167118087 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (3E,5R,6R)-6-(methylamino)-4-(methyliminomethyl)nona-1,3-dien-5-ol |
| SMILES | C=C/C=C(\C=N\C)[C@@H](O)[C@@H](CCC)NC |
| InChI | InChI=1S/C12H22N2O/c1-5-7-10(9-13-3)12(15)11(14-4)8-6-2/h5,7,9,11-12,14-15H,1,6,8H2,2-4H3/b10-7+,13-9+/t11-,12-/m1/s1 |
| InChIKey | DHKBGLQJTCYVHU-WMPSCBDJSA-N |
| XLogP | 1.55 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|