About (Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile
(Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile (PubChem CID 167118586) has the molecular formula C12H18N2S
and a molecular weight of 222.36 g/mol. Its IUPAC name is (Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile.
Molecular Properties
| Compound Name | (Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile |
| PubChem CID | 167118586 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile |
| SMILES | C/C=C(/CC#N)SC1=C(C)CCN(C)C1 |
| InChI | InChI=1S/C12H18N2S/c1-4-11(5-7-13)15-12-9-14(3)8-6-10(12)2/h4H,5-6,8-9H2,1-3H3/b11-4- |
| InChIKey | WURKSYFCDZPMDX-WCIBSUBMSA-N |
| XLogP | 3.15 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile?
The IUPAC name of (Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile (CID 167118586) is (Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile.
What is the SMILES notation for (Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile?
The canonical SMILES for (Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile is C/C=C(/CC#N)SC1=C(C)CCN(C)C1.
What is the InChIKey of (Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile?
The InChIKey is WURKSYFCDZPMDX-WCIBSUBMSA-N. The full InChI is InChI=1S/C12H18N2S/c1-4-11(5-7-13)15-12-9-14(3)8-6-10(12)2/h4H,5-6,8-9H2,1-3H3/b11-4-.
What are the key properties of (Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile?
(Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile has a molecular weight of 222.36 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)sulfanyl]pent-3-enenitrile is sourced from PubChem (CID 167118586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).