About N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine
N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine (PubChem CID 167120102) has the molecular formula C8H5Cl3FN3
and a molecular weight of 268.51 g/mol. Its IUPAC name is N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine.
Molecular Properties
| Compound Name | N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine |
| PubChem CID | 167120102 |
| Molecular Formula | C8H5Cl3FN3 |
| Molecular Weight | 268.51 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine |
| SMILES | C=N/C(Cl)=C(/F)c1nc(Cl)nc(Cl)c1C |
| InChI | InChI=1S/C8H5Cl3FN3/c1-3-5(4(12)7(10)13-2)14-8(11)15-6(3)9/h2H2,1H3/b7-4+ |
| InChIKey | WYYWVFFVZSYQMT-QPJJXVBHSA-N |
| XLogP | 3.63 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine?
The IUPAC name of N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine (CID 167120102) is N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine.
What is the SMILES notation for N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine?
The canonical SMILES for N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine is C=N/C(Cl)=C(/F)c1nc(Cl)nc(Cl)c1C.
What is the InChIKey of N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine?
The InChIKey is WYYWVFFVZSYQMT-QPJJXVBHSA-N. The full InChI is InChI=1S/C8H5Cl3FN3/c1-3-5(4(12)7(10)13-2)14-8(11)15-6(3)9/h2H2,1H3/b7-4+.
What are the key properties of N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine?
N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine has a molecular weight of 268.51 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1-chloro-2-(2,6-dichloro-5-methylpyrimidin-4-yl)-2-fluoroethenyl]methanimine is sourced from PubChem (CID 167120102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).