C13H22O4 — CID 167120522
2'-(2-methoxyethoxy)spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene] (PubChem CID 167120522) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is 2'-(2-methoxyethoxy)spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene].
| Compound Name | 2'-(2-methoxyethoxy)spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene] |
|---|---|
| PubChem CID | 167120522 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2'-(2-methoxyethoxy)spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene] |
| SMILES | COCCOC1CC2CC3(CC2C1)OCCO3 |
| InChI | InChI=1S/C13H22O4/c1-14-2-3-15-12-6-10-8-13(9-11(10)7-12)16-4-5-17-13/h10-12H,2-9H2,1H3 |
| InChIKey | FREGLDXQSJZQKD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|