About (1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine
(1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine (PubChem CID 167120722) has the molecular formula C10H17FN2
and a molecular weight of 184.26 g/mol. Its IUPAC name is (1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine.
Molecular Properties
| Compound Name | (1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine |
| PubChem CID | 167120722 |
| Molecular Formula | C10H17FN2 |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | (1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine |
| SMILES | C=CN(/C=C(/F)C(=C)NC)C(C)C |
| InChI | InChI=1S/C10H17FN2/c1-6-13(8(2)3)7-10(11)9(4)12-5/h6-8,12H,1,4H2,2-3,5H3/b10-7+ |
| InChIKey | PIVKZWOGJXEWPT-JXMROGBWSA-N |
| XLogP | 2.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine?
The IUPAC name of (1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine (CID 167120722) is (1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine.
What is the SMILES notation for (1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine?
The canonical SMILES for (1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine is C=CN(/C=C(/F)C(=C)NC)C(C)C.
What is the InChIKey of (1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine?
The InChIKey is PIVKZWOGJXEWPT-JXMROGBWSA-N. The full InChI is InChI=1S/C10H17FN2/c1-6-13(8(2)3)7-10(11)9(4)12-5/h6-8,12H,1,4H2,2-3,5H3/b10-7+.
What are the key properties of (1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine?
(1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine has a molecular weight of 184.26 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-N-ethenyl-2-fluoro-3-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine is sourced from PubChem (CID 167120722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).