C32H44N8O5 — CID 167121433
tert-butyl N-[[5-[2-amino-4-[butyl-[2-(pyrrolidine-1-carbonylamino)ethoxy]carbamoyl]-3H-1-benzazepin-8-yl]pyrimidin-2-yl]methyl]carbamate (PubChem CID 167121433) has the molecular formula C32H44N8O5 and a molecular weight of 620.76 g/mol. Its IUPAC name is tert-butyl N-[[5-[2-amino-4-[butyl-[2-(pyrrolidine-1-carbonylamino)ethoxy]carbamoyl]-3H-1-benzazepin-8-yl]pyrimidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[2-amino-4-[butyl-[2-(pyrrolidine-1-carbonylamino)ethoxy]carbamoyl]-3H-1-benzazepin-8-yl]pyrimidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 167121433 |
| Molecular Formula | C32H44N8O5 |
| Molecular Weight | 620.76 g/mol |
| Exact Mass | 620.34 |
| IUPAC Name | tert-butyl N-[[5-[2-amino-4-[butyl-[2-(pyrrolidine-1-carbonylamino)ethoxy]carbamoyl]-3H-1-benzazepin-8-yl]pyrimidin-2-yl]methyl]carbamate |
| SMILES | CCCCN(OCCNC(=O)N1CCCC1)C(=O)C1=Cc2ccc(-c3cnc(CNC(=O)OC(C)(C)C)nc3)cc2N=C(N)C1 |
| InChI | InChI=1S/C32H44N8O5/c1-5-6-14-40(44-15-11-34-30(42)39-12-7-8-13-39)29(41)24-16-23-10-9-22(17-26(23)38-27(33)18-24)25-19-35-28(36-20-25)21-37-31(43)45-32(2,3)4/h9-10,16-17,19-20H,5-8,11-15,18,21H2,1-4H3,(H2,33,38)(H,34,42)(H,37,43) |
| InChIKey | IYKQSRWNSRDFDQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|