C22H23N3 — CID 167122055
2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]cyclohexa-1,5-dien-1-yl]-1,3,5-triazine (PubChem CID 167122055) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]cyclohexa-1,5-dien-1-yl]-1,3,5-triazine.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]cyclohexa-1,5-dien-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 167122055 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]cyclohexa-1,5-dien-1-yl]-1,3,5-triazine |
| SMILES | C=C/C=C\C=C\C1C=CC(c2ncnc(C(/C=C\C)=C/C=C)n2)=CC1 |
| InChI | InChI=1S/C22H23N3/c1-4-7-8-9-12-18-13-15-20(16-14-18)22-24-17-23-21(25-22)19(10-5-2)11-6-3/h4-13,15-18H,1-2,14H2,3H3/b8-7-,11-6-,12-9+,19-10+ |
| InChIKey | ILWXGKFNDBSJAQ-XXNLNCSSSA-N |
| XLogP | 5.28 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|