C36H8F6N8O — CID 167122131
2-[3-cyano-4-(trifluoromethoxy)phenyl]-6-[4-cyano-3-(trifluoromethyl)phenyl]-3,7-bis(dicyanomethylidene)-s-indacene-1,5-dicarbonitrile (PubChem CID 167122131) has the molecular formula C36H8F6N8O and a molecular weight of 682.50 g/mol. Its IUPAC name is 2-[3-cyano-4-(trifluoromethoxy)phenyl]-6-[4-cyano-3-(trifluoromethyl)phenyl]-3,7-bis(dicyanomethylidene)-s-indacene-1,5-dicarbonitrile.
| Compound Name | 2-[3-cyano-4-(trifluoromethoxy)phenyl]-6-[4-cyano-3-(trifluoromethyl)phenyl]-3,7-bis(dicyanomethylidene)-s-indacene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 167122131 |
| Molecular Formula | C36H8F6N8O |
| Molecular Weight | 682.50 g/mol |
| Exact Mass | 682.07 |
| IUPAC Name | 2-[3-cyano-4-(trifluoromethoxy)phenyl]-6-[4-cyano-3-(trifluoromethyl)phenyl]-3,7-bis(dicyanomethylidene)-s-indacene-1,5-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2ccc(OC(F)(F)F)c(C#N)c2)=C(C#N)c2cc3c(cc21)C(C#N)=C(c1ccc(C#N)c(C(F)(F)F)c1)C3=C(C#N)C#N |
| InChI | InChI=1S/C36H8F6N8O/c37-35(38,39)29-6-18(1-2-19(29)9-43)32-28(16-50)24-8-25-23(7-26(24)34(32)22(13-47)14-48)27(15-49)31(33(25)21(11-45)12-46)17-3-4-30(20(5-17)10-44)51-36(40,41)42/h1-8H |
| InChIKey | BVFDKFOQKJGOAJ-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 199.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.50 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|