About trioctoxyalumane
trioctoxyalumane (PubChem CID 16712392) has the molecular formula C24H51AlO3
and a molecular weight of 414.65 g/mol. Its IUPAC name is trioctoxyalumane.
Molecular Properties
| Compound Name | trioctoxyalumane |
| PubChem CID | 16712392 |
| Molecular Formula | C24H51AlO3 |
| Molecular Weight | 414.65 g/mol |
| Exact Mass | 414.37 |
| IUPAC Name | trioctoxyalumane |
| SMILES | CCCCCCCCO[Al](OCCCCCCCC)OCCCCCCCC |
| InChI | InChI=1S/3C8H17O.Al/c3*1-2-3-4-5-6-7-8-9;/h3*2-8H2,1H3;/q3*-1;+3 |
| InChIKey | ZFYVMCFENKKDFG-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.65 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze trioctoxyalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trioctoxyalumane?
The IUPAC name of trioctoxyalumane (CID 16712392) is trioctoxyalumane.
What is the SMILES notation for trioctoxyalumane?
The canonical SMILES for trioctoxyalumane is CCCCCCCCO[Al](OCCCCCCCC)OCCCCCCCC.
What is the InChIKey of trioctoxyalumane?
The InChIKey is ZFYVMCFENKKDFG-UHFFFAOYSA-N. The full InChI is InChI=1S/3C8H17O.Al/c3*1-2-3-4-5-6-7-8-9;/h3*2-8H2,1H3;/q3*-1;+3.
What are the key properties of trioctoxyalumane?
trioctoxyalumane has a molecular weight of 414.65 g/mol, XLogP of 8.10, 24 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trioctoxyalumane is sourced from PubChem (CID 16712392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).