C51H32F6N2O — CID 167125538
12,12,13,13,14,14-hexafluoro-7-(2,4,6-triphenylphenyl)-16,19-diazaoctacyclo[22.2.2.15,9.02,22.04,20.010,18.011,15.019,29]nonacosa-2(22),3,5(29),6,8,10,15,17,20-nonaen-23-one (PubChem CID 167125538) has the molecular formula C51H32F6N2O and a molecular weight of 802.82 g/mol. Its IUPAC name is 12,12,13,13,14,14-hexafluoro-7-(2,4,6-triphenylphenyl)-16,19-diazaoctacyclo[22.2.2.15,9.02,22.04,20.010,18.011,15.019,29]nonacosa-2(22),3,5(29),6,8,10,15,17,20-nonaen-23-one.
| Compound Name | 12,12,13,13,14,14-hexafluoro-7-(2,4,6-triphenylphenyl)-16,19-diazaoctacyclo[22.2.2.15,9.02,22.04,20.010,18.011,15.019,29]nonacosa-2(22),3,5(29),6,8,10,15,17,20-nonaen-23-one |
|---|---|
| PubChem CID | 167125538 |
| Molecular Formula | C51H32F6N2O |
| Molecular Weight | 802.82 g/mol |
| Exact Mass | 802.24 |
| IUPAC Name | 12,12,13,13,14,14-hexafluoro-7-(2,4,6-triphenylphenyl)-16,19-diazaoctacyclo[22.2.2.15,9.02,22.04,20.010,18.011,15.019,29]nonacosa-2(22),3,5(29),6,8,10,15,17,20-nonaen-23-one |
| SMILES | O=C1c2cc3c(cc2C2CCC1CC2)c1cc(-c2c(-c4ccccc4)cc(-c4ccccc4)cc2-c2ccccc2)cc2c4c5c(ncc4n3c12)C(F)(F)C(F)(F)C5(F)F |
| InChI | InChI=1S/C51H32F6N2O/c52-49(53)45-44-40-23-33(43-35(28-12-6-2-7-13-28)20-32(27-10-4-1-5-11-27)21-36(43)29-14-8-3-9-15-29)22-38-37-24-34-30-16-18-31(19-17-30)47(60)39(34)25-41(37)59(46(38)40)42(44)26-58-48(45)50(54,55)51(49,56)57/h1-15,20-26,30-31H,16-19H2 |
| InChIKey | YVCGNQPRWAUKIF-UHFFFAOYSA-N |
| XLogP | 14.20 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.82 |
| LogP ≤ 5 | 14.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|