About 3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one
3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one (PubChem CID 167126243) has the molecular formula C20H19Cl2N3O4
and a molecular weight of 436.30 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one |
| PubChem CID | 167126243 |
| Molecular Formula | C20H19Cl2N3O4 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one |
| SMILES | COc1cc(-c2cc(Cl)c(Oc3cc(C(C)C)c(=O)[nH]n3)c(Cl)c2)cnc1OC |
| InChI | InChI=1S/C20H19Cl2N3O4/c1-10(2)13-8-17(24-25-19(13)26)29-18-14(21)5-11(6-15(18)22)12-7-16(27-3)20(28-4)23-9-12/h5-10H,1-4H3,(H,25,26) |
| InChIKey | BXHLPQWGCMWAPE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one?
The IUPAC name of 3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one (CID 167126243) is 3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one.
What is the SMILES notation for 3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one?
The canonical SMILES for 3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one is COc1cc(-c2cc(Cl)c(Oc3cc(C(C)C)c(=O)[nH]n3)c(Cl)c2)cnc1OC.
What is the InChIKey of 3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one?
The InChIKey is BXHLPQWGCMWAPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Cl2N3O4/c1-10(2)13-8-17(24-25-19(13)26)29-18-14(21)5-11(6-15(18)22)12-7-16(27-3)20(28-4)23-9-12/h5-10H,1-4H3,(H,25,26).
What are the key properties of 3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one?
3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one has a molecular weight of 436.30 g/mol, XLogP of 5.07, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-dichloro-4-(5,6-dimethoxy-3-pyridinyl)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one is sourced from PubChem (CID 167126243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).