C13H23N5O — CID 167126985
2-[[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-ylidene]amino]-1-piperazin-1-ylethanone (PubChem CID 167126985) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-ylidene]amino]-1-piperazin-1-ylethanone.
| Compound Name | 2-[[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-ylidene]amino]-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 167126985 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 2-[[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-ylidene]amino]-1-piperazin-1-ylethanone |
| SMILES | O=C(C/N=C1\N[C@H]2CCCC[C@H]2N1)N1CCNCC1 |
| InChI | InChI=1S/C13H23N5O/c19-12(18-7-5-14-6-8-18)9-15-13-16-10-3-1-2-4-11(10)17-13/h10-11,14H,1-9H2,(H2,15,16,17)/t10-,11+ |
| InChIKey | PGZSULSDXHUKQU-PHIMTYICSA-N |
| XLogP | -0.72 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|