C14H24N4O — CID 167126987
2-[[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-ylidene]amino]-1-piperidin-1-ylethanone (PubChem CID 167126987) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-[[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-ylidene]amino]-1-piperidin-1-ylethanone.
| Compound Name | 2-[[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-ylidene]amino]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 167126987 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 2-[[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-ylidene]amino]-1-piperidin-1-ylethanone |
| SMILES | O=C(C/N=C1\N[C@H]2CCCC[C@H]2N1)N1CCCCC1 |
| InChI | InChI=1S/C14H24N4O/c19-13(18-8-4-1-5-9-18)10-15-14-16-11-6-2-3-7-12(11)17-14/h11-12H,1-10H2,(H2,15,16,17)/t11-,12+ |
| InChIKey | SQFZKVHOWCMDQJ-TXEJJXNPSA-N |
| XLogP | 0.86 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|