C27H29NO2 — CID 167130948
(3R,6R,7aR)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-7a-[(4-phenylphenyl)methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one (PubChem CID 167130948) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is (3R,6R,7aR)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-7a-[(4-phenylphenyl)methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one.
| Compound Name | (3R,6R,7aR)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-7a-[(4-phenylphenyl)methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 167130948 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (3R,6R,7aR)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-7a-[(4-phenylphenyl)methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
| SMILES | C=C(/C=C\C=C/C)[C@@H]1CO[C@@]2(Cc3ccc(-c4ccccc4)cc3)C[C@@H](C)C(=O)N12 |
| InChI | InChI=1S/C27H29NO2/c1-4-5-7-10-20(2)25-19-30-27(17-21(3)26(29)28(25)27)18-22-13-15-24(16-14-22)23-11-8-6-9-12-23/h4-16,21,25H,2,17-19H2,1,3H3/b5-4-,10-7-/t21-,25+,27-/m1/s1 |
| InChIKey | MKADYKSGHCFLEZ-SORSLYLLSA-N |
| XLogP | 5.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|