C29H25ClN4O3 — CID 167131554
3-[3-chloro-4-(2,3-dimethylphenoxy)phenyl]-1-[3-(1-hydroxyprop-2-enylamino)phenyl]imidazo[4,5-c]pyridin-2-one (PubChem CID 167131554) has the molecular formula C29H25ClN4O3 and a molecular weight of 513.00 g/mol. Its IUPAC name is 3-[3-chloro-4-(2,3-dimethylphenoxy)phenyl]-1-[3-(1-hydroxyprop-2-enylamino)phenyl]imidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[3-chloro-4-(2,3-dimethylphenoxy)phenyl]-1-[3-(1-hydroxyprop-2-enylamino)phenyl]imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 167131554 |
| Molecular Formula | C29H25ClN4O3 |
| Molecular Weight | 513.00 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 3-[3-chloro-4-(2,3-dimethylphenoxy)phenyl]-1-[3-(1-hydroxyprop-2-enylamino)phenyl]imidazo[4,5-c]pyridin-2-one |
| SMILES | C=CC(O)Nc1cccc(-n2c(=O)n(-c3ccc(Oc4cccc(C)c4C)c(Cl)c3)c3cnccc32)c1 |
| InChI | InChI=1S/C29H25ClN4O3/c1-4-28(35)32-20-8-6-9-21(15-20)33-24-13-14-31-17-25(24)34(29(33)36)22-11-12-27(23(30)16-22)37-26-10-5-7-18(2)19(26)3/h4-17,28,32,35H,1H2,2-3H3 |
| InChIKey | RVLAZHNFHWJQQS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.00 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|