C21H24O2 — CID 167131881
(3Z,5Z)-5-(4-acetylphenyl)-3-[(1Z)-buta-1,3-dienyl]-4-methylocta-3,5-dien-2-one (PubChem CID 167131881) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is (3Z,5Z)-5-(4-acetylphenyl)-3-[(1Z)-buta-1,3-dienyl]-4-methylocta-3,5-dien-2-one.
| Compound Name | (3Z,5Z)-5-(4-acetylphenyl)-3-[(1Z)-buta-1,3-dienyl]-4-methylocta-3,5-dien-2-one |
|---|---|
| PubChem CID | 167131881 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (3Z,5Z)-5-(4-acetylphenyl)-3-[(1Z)-buta-1,3-dienyl]-4-methylocta-3,5-dien-2-one |
| SMILES | C=C/C=C\C(C(C)=O)=C(C)\C(=C/CC)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C21H24O2/c1-6-8-10-20(17(5)23)15(3)21(9-7-2)19-13-11-18(12-14-19)16(4)22/h6,8-14H,1,7H2,2-5H3/b10-8-,20-15-,21-9- |
| InChIKey | WEOWRZSZLKTFNY-KEBYEJNJSA-N |
| XLogP | 5.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|