C24H31N — CID 167132004
(3Z,5Z)-2-butan-2-yl-N-cyclopenta-1,4-dien-1-yl-1-(5-methylcyclohepta-1,3,6-trien-1-yl)hepta-3,5-dien-1-imine (PubChem CID 167132004) has the molecular formula C24H31N and a molecular weight of 333.52 g/mol. Its IUPAC name is (3Z,5Z)-2-butan-2-yl-N-cyclopenta-1,4-dien-1-yl-1-(5-methylcyclohepta-1,3,6-trien-1-yl)hepta-3,5-dien-1-imine.
| Compound Name | (3Z,5Z)-2-butan-2-yl-N-cyclopenta-1,4-dien-1-yl-1-(5-methylcyclohepta-1,3,6-trien-1-yl)hepta-3,5-dien-1-imine |
|---|---|
| PubChem CID | 167132004 |
| Molecular Formula | C24H31N |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | (3Z,5Z)-2-butan-2-yl-N-cyclopenta-1,4-dien-1-yl-1-(5-methylcyclohepta-1,3,6-trien-1-yl)hepta-3,5-dien-1-imine |
| SMILES | C/C=C\C=C/C(/C(=N/C1=CCC=C1)C1=CC=CC(C)C=C1)C(C)CC |
| InChI | InChI=1S/C24H31N/c1-5-7-8-16-23(20(4)6-2)24(25-22-14-9-10-15-22)21-13-11-12-19(3)17-18-21/h5,7-9,11-20,23H,6,10H2,1-4H3/b7-5-,16-8-,25-24+ |
| InChIKey | ZMAXZGFJNDZUQN-MVGXFFGZSA-N |
| XLogP | 6.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|