About 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane
2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 16713273) has the molecular formula C24H33OP
and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane.
Molecular Properties
| Compound Name | 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane |
| PubChem CID | 16713273 |
| Molecular Formula | C24H33OP |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(PC#Cc2ccco2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H33OP/c1-22(2,3)17-15-19(23(4,5)6)21(20(16-17)24(7,8)9)26-14-12-18-11-10-13-25-18/h10-11,13,15-16,26H,1-9H3 |
| InChIKey | YKQOQOVGBVTDJJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane?
The IUPAC name of 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane (CID 16713273) is 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane.
What is the SMILES notation for 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane?
The canonical SMILES for 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane is CC(C)(C)c1cc(C(C)(C)C)c(PC#Cc2ccco2)c(C(C)(C)C)c1.
What is the InChIKey of 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane?
The InChIKey is YKQOQOVGBVTDJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33OP/c1-22(2,3)17-15-19(23(4,5)6)21(20(16-17)24(7,8)9)26-14-12-18-11-10-13-25-18/h10-11,13,15-16,26H,1-9H3.
What are the key properties of 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane?
2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane has a molecular weight of 368.50 g/mol, XLogP of 6.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane is sourced from PubChem (CID 16713273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).