C24H33OP — CID 16713273
2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 16713273) has the molecular formula C24H33OP and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 16713273 |
| Molecular Formula | C24H33OP |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 2-(furan-2-yl)ethynyl-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(PC#Cc2ccco2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H33OP/c1-22(2,3)17-15-19(23(4,5)6)21(20(16-17)24(7,8)9)26-14-12-18-11-10-13-25-18/h10-11,13,15-16,26H,1-9H3 |
| InChIKey | YKQOQOVGBVTDJJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|