C9H11NO2 — CID 167132961
N-[(3E,5E)-6-hydroxyocta-1,3,5,7-tetraen-3-yl]formamide (PubChem CID 167132961) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is N-[(3E,5E)-6-hydroxyocta-1,3,5,7-tetraen-3-yl]formamide.
| Compound Name | N-[(3E,5E)-6-hydroxyocta-1,3,5,7-tetraen-3-yl]formamide |
|---|---|
| PubChem CID | 167132961 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | N-[(3E,5E)-6-hydroxyocta-1,3,5,7-tetraen-3-yl]formamide |
| SMILES | C=C/C(O)=C\C=C(/C=C)NC=O |
| InChI | InChI=1S/C9H11NO2/c1-3-8(10-7-11)5-6-9(12)4-2/h3-7,12H,1-2H2,(H,10,11)/b8-5+,9-6+ |
| InChIKey | TVDBUGDRFCBSHZ-XVYDYJIPSA-N |
| XLogP | 1.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|