About 6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione
6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione (PubChem CID 167133257) has the molecular formula C15H14N4S2
and a molecular weight of 314.44 g/mol. Its IUPAC name is 6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione.
Molecular Properties
| Compound Name | 6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione |
| PubChem CID | 167133257 |
| Molecular Formula | C15H14N4S2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione |
| SMILES | C=C1NC(=S)Nc2nc(SC/C=C/c3ccccc3)[nH]c21 |
| InChI | InChI=1S/C15H14N4S2/c1-10-12-13(18-14(20)16-10)19-15(17-12)21-9-5-8-11-6-3-2-4-7-11/h2-8H,1,9H2,(H,17,19)(H2,16,18,20)/b8-5+ |
| InChIKey | YJOUTMQCJRQMJW-VMPITWQZSA-N |
| XLogP | 3.49 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione?
The IUPAC name of 6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione (CID 167133257) is 6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione.
What is the SMILES notation for 6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione?
The canonical SMILES for 6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione is C=C1NC(=S)Nc2nc(SC/C=C/c3ccccc3)[nH]c21.
What is the InChIKey of 6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione?
The InChIKey is YJOUTMQCJRQMJW-VMPITWQZSA-N. The full InChI is InChI=1S/C15H14N4S2/c1-10-12-13(18-14(20)16-10)19-15(17-12)21-9-5-8-11-6-3-2-4-7-11/h2-8H,1,9H2,(H,17,19)(H2,16,18,20)/b8-5+.
What are the key properties of 6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione?
6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione has a molecular weight of 314.44 g/mol, XLogP of 3.49, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylidene-8-[(E)-3-phenylprop-2-enyl]sulfanyl-3,7-dihydropurine-2-thione is sourced from PubChem (CID 167133257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).