C21H25F4N7O2 — CID 167133836
1-[(3S,4R)-3-[[2-[[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]methyl]-5-fluoro-5-methyl-6,7-dihydropyrrolo[2,3-d]pyrimidin-4-yl]oxy]-4-fluoropiperidin-1-yl]prop-2-en-1-one (PubChem CID 167133836) has the molecular formula C21H25F4N7O2 and a molecular weight of 483.47 g/mol. Its IUPAC name is 1-[(3S,4R)-3-[[2-[[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]methyl]-5-fluoro-5-methyl-6,7-dihydropyrrolo[2,3-d]pyrimidin-4-yl]oxy]-4-fluoropiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S,4R)-3-[[2-[[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]methyl]-5-fluoro-5-methyl-6,7-dihydropyrrolo[2,3-d]pyrimidin-4-yl]oxy]-4-fluoropiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167133836 |
| Molecular Formula | C21H25F4N7O2 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 1-[(3S,4R)-3-[[2-[[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]methyl]-5-fluoro-5-methyl-6,7-dihydropyrrolo[2,3-d]pyrimidin-4-yl]oxy]-4-fluoropiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](F)[C@@H](Oc2nc(CNc3cnn(CC(F)F)c3)nc3c2C(C)(F)CN3)C1 |
| InChI | InChI=1S/C21H25F4N7O2/c1-3-17(33)31-5-4-13(22)14(9-31)34-20-18-19(27-11-21(18,2)25)29-16(30-20)7-26-12-6-28-32(8-12)10-15(23)24/h3,6,8,13-15,26H,1,4-5,7,9-11H2,2H3,(H,27,29,30)/t13-,14+,21?/m1/s1 |
| InChIKey | RWZLAYUUZSMJQP-LOPBJPMSSA-N |
| XLogP | 2.66 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|