About 5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one
5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one (PubChem CID 167134276) has the molecular formula C20H21FN2O2
and a molecular weight of 340.40 g/mol. Its IUPAC name is 5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one.
Molecular Properties
| Compound Name | 5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one |
| PubChem CID | 167134276 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one |
| SMILES | Cc1cc(F)cc(C)c1OC1=C(c2ccc(=O)n(C)c2)C=CN(C)C1 |
| InChI | InChI=1S/C20H21FN2O2/c1-13-9-16(21)10-14(2)20(13)25-18-12-22(3)8-7-17(18)15-5-6-19(24)23(4)11-15/h5-11H,12H2,1-4H3 |
| InChIKey | YQUFCUGEWBVIRP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one?
The IUPAC name of 5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one (CID 167134276) is 5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one.
What is the SMILES notation for 5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one?
The canonical SMILES for 5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one is Cc1cc(F)cc(C)c1OC1=C(c2ccc(=O)n(C)c2)C=CN(C)C1.
What is the InChIKey of 5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one?
The InChIKey is YQUFCUGEWBVIRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN2O2/c1-13-9-16(21)10-14(2)20(13)25-18-12-22(3)8-7-17(18)15-5-6-19(24)23(4)11-15/h5-11H,12H2,1-4H3.
What are the key properties of 5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one?
5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one has a molecular weight of 340.40 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(4-fluoro-2,6-dimethylphenoxy)-1-methyl-2H-pyridin-4-yl]-1-methylpyridin-2-one is sourced from PubChem (CID 167134276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).