About 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole
5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole (PubChem CID 167134467) has the molecular formula C18H28N4
and a molecular weight of 300.45 g/mol. Its IUPAC name is 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole.
Molecular Properties
| Compound Name | 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole |
| PubChem CID | 167134467 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole |
| SMILES | Cc1ccc(C)n1-c1cc(C(C)(C)C)n([C@H]2CCN(C)C2)n1 |
| InChI | InChI=1S/C18H28N4/c1-13-7-8-14(2)21(13)17-11-16(18(3,4)5)22(19-17)15-9-10-20(6)12-15/h7-8,11,15H,9-10,12H2,1-6H3/t15-/m0/s1 |
| InChIKey | VRTUNTICDZSPED-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_E(5)', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole?
The IUPAC name of 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole (CID 167134467) is 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole.
What is the SMILES notation for 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole?
The canonical SMILES for 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole is Cc1ccc(C)n1-c1cc(C(C)(C)C)n([C@H]2CCN(C)C2)n1.
What is the InChIKey of 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole?
The InChIKey is VRTUNTICDZSPED-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H28N4/c1-13-7-8-14(2)21(13)17-11-16(18(3,4)5)22(19-17)15-9-10-20(6)12-15/h7-8,11,15H,9-10,12H2,1-6H3/t15-/m0/s1.
What are the key properties of 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole?
5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole has a molecular weight of 300.45 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-1-methylpyrrolidin-3-yl]pyrazole is sourced from PubChem (CID 167134467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).