C19H15N11 — CID 167134882
3-(cyanomethyl)-3-[13-(1-methylpyrazol-4-yl)-4,5,7,10,11,14-hexazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2,5,8(15),9,12-hexaen-4-yl]azetidine-1-carbonitrile (PubChem CID 167134882) has the molecular formula C19H15N11 and a molecular weight of 397.41 g/mol. Its IUPAC name is 3-(cyanomethyl)-3-[13-(1-methylpyrazol-4-yl)-4,5,7,10,11,14-hexazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2,5,8(15),9,12-hexaen-4-yl]azetidine-1-carbonitrile.
| Compound Name | 3-(cyanomethyl)-3-[13-(1-methylpyrazol-4-yl)-4,5,7,10,11,14-hexazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2,5,8(15),9,12-hexaen-4-yl]azetidine-1-carbonitrile |
|---|---|
| PubChem CID | 167134882 |
| Molecular Formula | C19H15N11 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-(cyanomethyl)-3-[13-(1-methylpyrazol-4-yl)-4,5,7,10,11,14-hexazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2,5,8(15),9,12-hexaen-4-yl]azetidine-1-carbonitrile |
| SMILES | Cn1cc(-c2cn3ncc4c3c(n2)-c2cn(C3(CC#N)CN(C#N)C3)nc2N4)cn1 |
| InChI | InChI=1S/C19H15N11/c1-27-6-12(4-22-27)15-8-29-17-14(5-23-29)25-18-13(16(17)24-15)7-30(26-18)19(2-3-20)9-28(10-19)11-21/h4-8H,2,9-10H2,1H3,(H,25,26) |
| InChIKey | GAUFJGRGINWYDZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 128.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|