C26H36N4OS — CID 167134898
(2Z,4Z,6E)-5-[[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]methyl]-3-(1-pyridin-4-ylethoxy)nona-2,4,6-trien-2-amine (PubChem CID 167134898) has the molecular formula C26H36N4OS and a molecular weight of 452.67 g/mol. Its IUPAC name is (2Z,4Z,6E)-5-[[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]methyl]-3-(1-pyridin-4-ylethoxy)nona-2,4,6-trien-2-amine.
| Compound Name | (2Z,4Z,6E)-5-[[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]methyl]-3-(1-pyridin-4-ylethoxy)nona-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 167134898 |
| Molecular Formula | C26H36N4OS |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | (2Z,4Z,6E)-5-[[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]methyl]-3-(1-pyridin-4-ylethoxy)nona-2,4,6-trien-2-amine |
| SMILES | CC/C=C/C(=C\C(OC(C)c1ccncc1)=C(/C)N)Cc1cnc(C2CCN(C)CC2)s1 |
| InChI | InChI=1S/C26H36N4OS/c1-5-6-7-21(16-24-18-29-26(32-24)23-10-14-30(4)15-11-23)17-25(19(2)27)31-20(3)22-8-12-28-13-9-22/h6-9,12-13,17-18,20,23H,5,10-11,14-16,27H2,1-4H3/b7-6+,21-17+,25-19- |
| InChIKey | LBIIHQLICYDHCV-STTXQYISSA-N |
| XLogP | 5.75 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|