C10H18N2O — CID 167135040
(4aR,8aS)-6-propan-2-yl-1,2,3,4a,5,8a-hexahydropyrido[3,4-b][1,4]oxazine (PubChem CID 167135040) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (4aR,8aS)-6-propan-2-yl-1,2,3,4a,5,8a-hexahydropyrido[3,4-b][1,4]oxazine.
| Compound Name | (4aR,8aS)-6-propan-2-yl-1,2,3,4a,5,8a-hexahydropyrido[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 167135040 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (4aR,8aS)-6-propan-2-yl-1,2,3,4a,5,8a-hexahydropyrido[3,4-b][1,4]oxazine |
| SMILES | CC(C)N1C=C[C@@H]2NCCO[C@@H]2C1 |
| InChI | InChI=1S/C10H18N2O/c1-8(2)12-5-3-9-10(7-12)13-6-4-11-9/h3,5,8-11H,4,6-7H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | NHWOIYCCJPXEKZ-VHSXEESVSA-N |
| XLogP | 0.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |