C27H31ClFN3O3 — CID 167135181
tert-butyl 6-(5-chloro-2-fluorophenyl)-8-[(2E,4Z)-5-methanimidoylocta-2,4-dien-3-yl]-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxylate (PubChem CID 167135181) has the molecular formula C27H31ClFN3O3 and a molecular weight of 500.01 g/mol. Its IUPAC name is tert-butyl 6-(5-chloro-2-fluorophenyl)-8-[(2E,4Z)-5-methanimidoylocta-2,4-dien-3-yl]-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxylate.
| Compound Name | tert-butyl 6-(5-chloro-2-fluorophenyl)-8-[(2E,4Z)-5-methanimidoylocta-2,4-dien-3-yl]-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxylate |
|---|---|
| PubChem CID | 167135181 |
| Molecular Formula | C27H31ClFN3O3 |
| Molecular Weight | 500.01 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | tert-butyl 6-(5-chloro-2-fluorophenyl)-8-[(2E,4Z)-5-methanimidoylocta-2,4-dien-3-yl]-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxylate |
| SMILES | [H]/N=C/C(=C\C(=C/C)c1cc(-c2cc(Cl)ccc2F)nc2c1OCCN2C(=O)OC(C)(C)C)CCC |
| InChI | InChI=1S/C27H31ClFN3O3/c1-6-8-17(16-30)13-18(7-2)20-15-23(21-14-19(28)9-10-22(21)29)31-25-24(20)34-12-11-32(25)26(33)35-27(3,4)5/h7,9-10,13-16,30H,6,8,11-12H2,1-5H3/b17-13-,18-7+,30-16+ |
| InChIKey | ULMNNPMUSVCQSF-DZSXFAOOSA-N |
| XLogP | 7.45 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.01 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|