C28H36ClFN6O2 — CID 167135490
N-[(2E,4E)-4-[6-(5-chloro-2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-8-yl]-1-iminohexa-2,4-dien-2-yl]-4-[2-(propylamino)ethylamino]butanamide (PubChem CID 167135490) has the molecular formula C28H36ClFN6O2 and a molecular weight of 543.09 g/mol. Its IUPAC name is N-[(2E,4E)-4-[6-(5-chloro-2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-8-yl]-1-iminohexa-2,4-dien-2-yl]-4-[2-(propylamino)ethylamino]butanamide.
| Compound Name | N-[(2E,4E)-4-[6-(5-chloro-2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-8-yl]-1-iminohexa-2,4-dien-2-yl]-4-[2-(propylamino)ethylamino]butanamide |
|---|---|
| PubChem CID | 167135490 |
| Molecular Formula | C28H36ClFN6O2 |
| Molecular Weight | 543.09 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | N-[(2E,4E)-4-[6-(5-chloro-2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-8-yl]-1-iminohexa-2,4-dien-2-yl]-4-[2-(propylamino)ethylamino]butanamide |
| SMILES | [H]/N=C/C(=C\C(=C/C)c1cc(-c2cc(Cl)ccc2F)nc2c1OCCN2)NC(=O)CCCNCCNCCC |
| InChI | InChI=1S/C28H36ClFN6O2/c1-3-9-32-11-12-33-10-5-6-26(37)35-21(18-31)15-19(4-2)22-17-25(23-16-20(29)7-8-24(23)30)36-28-27(22)38-14-13-34-28/h4,7-8,15-18,31-33H,3,5-6,9-14H2,1-2H3,(H,34,36)(H,35,37)/b19-4+,21-15+,31-18+ |
| InChIKey | LUIJDEQTRCTHQH-NOQCOJFSSA-N |
| XLogP | 4.77 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.09 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|