C30H32ClFN6O2 — CID 167135647
(2R,4S)-1-N-(5-chloro-2-pyridinyl)-2-N-[5-[9-(2-cyclopropylethyl)-4,8-diazabicyclo[5.2.0]nona-1,3,5-trien-9-yl]-2-fluorophenyl]-4-methylpyrrolidine-1,2-dicarboxamide (PubChem CID 167135647) has the molecular formula C30H32ClFN6O2 and a molecular weight of 563.08 g/mol. Its IUPAC name is (2R,4S)-1-N-(5-chloro-2-pyridinyl)-2-N-[5-[9-(2-cyclopropylethyl)-4,8-diazabicyclo[5.2.0]nona-1,3,5-trien-9-yl]-2-fluorophenyl]-4-methylpyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4S)-1-N-(5-chloro-2-pyridinyl)-2-N-[5-[9-(2-cyclopropylethyl)-4,8-diazabicyclo[5.2.0]nona-1,3,5-trien-9-yl]-2-fluorophenyl]-4-methylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 167135647 |
| Molecular Formula | C30H32ClFN6O2 |
| Molecular Weight | 563.08 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | (2R,4S)-1-N-(5-chloro-2-pyridinyl)-2-N-[5-[9-(2-cyclopropylethyl)-4,8-diazabicyclo[5.2.0]nona-1,3,5-trien-9-yl]-2-fluorophenyl]-4-methylpyrrolidine-1,2-dicarboxamide |
| SMILES | C[C@H]1C[C@H](C(=O)Nc2cc(C3(CCC4CC4)NC4C=CN=CC=C43)ccc2F)N(C(=O)Nc2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C30H32ClFN6O2/c1-18-14-26(38(17-18)29(40)36-27-7-5-21(31)16-34-27)28(39)35-25-15-20(4-6-23(25)32)30(11-8-19-2-3-19)22-9-12-33-13-10-24(22)37-30/h4-7,9-10,12-13,15-16,18-19,24,26,37H,2-3,8,11,14,17H2,1H3,(H,35,39)(H,34,36,40)/t18-,24?,26+,30?/m0/s1 |
| InChIKey | HWQAHVPRPKPUOP-ZTPGBZKCSA-N |
| XLogP | 5.64 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.08 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |