C19H25NO3S — CID 167136546
tert-butyl 3-methyl-4-[2-(4-methylphenyl)sulfanylethyl]-5-oxo-2H-pyrrole-1-carboxylate (PubChem CID 167136546) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is tert-butyl 3-methyl-4-[2-(4-methylphenyl)sulfanylethyl]-5-oxo-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-4-[2-(4-methylphenyl)sulfanylethyl]-5-oxo-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 167136546 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | tert-butyl 3-methyl-4-[2-(4-methylphenyl)sulfanylethyl]-5-oxo-2H-pyrrole-1-carboxylate |
| SMILES | CC1=C(CCSc2ccc(C)cc2)C(=O)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H25NO3S/c1-13-6-8-15(9-7-13)24-11-10-16-14(2)12-20(17(16)21)18(22)23-19(3,4)5/h6-9H,10-12H2,1-5H3 |
| InChIKey | VFUWPNDFAUZGPP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |