C28H40N4O5S2 — CID 167137119
S-[(E)-4-(4-methyl-2-methylsulfanyl-5,8,12-trioxo-9-oxa-3,6,13,16-tetrazabicyclo[13.3.1]nonadeca-1(19),2,15,17-tetraen-10-yl)but-3-enyl] octanethioate (PubChem CID 167137119) has the molecular formula C28H40N4O5S2 and a molecular weight of 576.79 g/mol. Its IUPAC name is S-[(E)-4-(4-methyl-2-methylsulfanyl-5,8,12-trioxo-9-oxa-3,6,13,16-tetrazabicyclo[13.3.1]nonadeca-1(19),2,15,17-tetraen-10-yl)but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-(4-methyl-2-methylsulfanyl-5,8,12-trioxo-9-oxa-3,6,13,16-tetrazabicyclo[13.3.1]nonadeca-1(19),2,15,17-tetraen-10-yl)but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 167137119 |
| Molecular Formula | C28H40N4O5S2 |
| Molecular Weight | 576.79 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | S-[(E)-4-(4-methyl-2-methylsulfanyl-5,8,12-trioxo-9-oxa-3,6,13,16-tetrazabicyclo[13.3.1]nonadeca-1(19),2,15,17-tetraen-10-yl)but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/C1CC(=O)NCc2cc(ccn2)/C(SC)=N/C(C)C(=O)NCC(=O)O1 |
| InChI | InChI=1S/C28H40N4O5S2/c1-4-5-6-7-8-12-26(35)39-15-10-9-11-23-17-24(33)30-18-22-16-21(13-14-29-22)28(38-3)32-20(2)27(36)31-19-25(34)37-23/h9,11,13-14,16,20,23H,4-8,10,12,15,17-19H2,1-3H3,(H,30,33)(H,31,36)/b11-9+,32-28- |
| InChIKey | BAUQBCLXLNHYDX-SVVUBISISA-N |
| XLogP | 4.19 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.79 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|